Molecular Structure:
CCD No.:CCD02027625
SELENA SEL10428075
Formula:C12 H23 N3 O3
MolWeight:257.332
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428075 |
| English Synonyms： | SELENA SEL10428075 |
| MDL Number.： | MFCD13212719 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CN(C)C(=O)CN(CCOC)C(=O)[C@@H]1CCCN1 |
| InChi： | InChI=1S/C12H23N3O3/c1-14(2)11(16)9-15(7-8-18-3)12(17)10-5-4-6-13-10/h10,13H,4-9H2,1-3H3/t10-/m0/s1 |
| InChiKey： | InChIKey=AIHMDINZFSSZPF-JTQLQIEISA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
