Molecular Structure:
CCD No.:CCD02027669
SELENA SEL10428181
Formula:C12 H21 N3 O2
MolWeight:239.317
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428181 |
| English Synonyms： | SELENA SEL10428181 |
| MDL Number.： | MFCD13212763 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | C1CCC(C1)N(CC(=O)N)C(=O)[C@@H]2CCCN2 |
| InChi： | InChI=1S/C12H21N3O2/c13-11(16)8-15(9-4-1-2-5-9)12(17)10-6-3-7-14-10/h9-10,14H,1-8H2,(H2,13,16)/t10-/m0/s1 |
| InChiKey： | InChIKey=OYMMGKFMNGDMBI-JTQLQIEISA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
