Molecular Structure:
CCD No.:CCD02027702
SELENA SEL10428267
Formula:C11 H17 F3 N2 O3
MolWeight:282.26
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428267 |
| English Synonyms： | SELENA SEL10428267 |
| MDL Number.： | MFCD13212796 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | COC(=O)CCN(CC(F)(F)F)C(=O)[C@@H]1CCCN1 |
| InChi： | InChI=1S/C11H17F3N2O3/c1-19-9(17)4-6-16(7-11(12,13)14)10(18)8-3-2-5-15-8/h8,15H,2-7H2,1H3/t8-/m0/s1 |
| InChiKey： | InChIKey=SHCJHQDFFIMBAM-QMMMGPOBSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
