Molecular Structure:
CCD No.:CCD02027752
SELENA SEL10428392
Formula:C13 H16 N2 O3
MolWeight:248.28
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428392 |
| English Synonyms： | SELENA SEL10428392 |
| MDL Number.： | MFCD13212846 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CN(CC(=O)OC)C(=O)[C@@H]1Cc2ccccc2N1 |
| InChi： | InChI=1S/C13H16N2O3/c1-15(8-12(16)18-2)13(17)11-7-9-5-3-4-6-10(9)14-11/h3-6,11,14H,7-8H2,1-2H3/t11-/m0/s1 |
| InChiKey： | InChIKey=ZMJDIDVUBCGFNJ-NSHDSACASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
