Molecular Structure:
CCD No.:CCD02027758
SELENA SEL10428407
Formula:C13 H19 N5 O
MolWeight:261.327
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428407 |
| English Synonyms： | SELENA SEL10428407 |
| MDL Number.： | MFCD13212852 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | c1cnc(cn1)N2CCN(CC2)C(=O)[C@@H]3CCCN3 |
| InChi： | InChI=1S/C13H19N5O/c19-13(11-2-1-3-15-11)18-8-6-17(7-9-18)12-10-14-4-5-16-12/h4-5,10-11,15H,1-3,6-9H2/t11-/m0/s1 |
| InChiKey： | InChIKey=CWHJPWAVODBGBE-NSHDSACASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
