Molecular Structure:
CCD No.:CCD02027759
SELENA SEL10428409
Formula:C13 H24 N4 O2
MolWeight:268.359
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428409 |
| English Synonyms： | SELENA SEL10428409 |
| MDL Number.： | MFCD13212853 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CN(C)CC(=O)N1CCN(CC1)C(=O)[C@@H]2CCCN2 |
| InChi： | InChI=1S/C13H24N4O2/c1-15(2)10-12(18)16-6-8-17(9-7-16)13(19)11-4-3-5-14-11/h11,14H,3-10H2,1-2H3/t11-/m0/s1 |
| InChiKey： | InChIKey=PELCXUNDPWWWMB-NSHDSACASA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
