Molecular Structure:
CCD No.:CCD02027763
SELENA SEL10428419
Formula:C13 H19 N3 O
MolWeight:233.313
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10428419 |
| English Synonyms： | SELENA SEL10428419 |
| MDL Number.： | MFCD13212857 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1cc([nH]c1)C2CCCN2C(=O)[C@@H]3CCCN3 |
| InChi： | InChI=1S/C13H19N3O/c17-13(11-5-2-8-15-11)16-9-3-6-12(16)10-4-1-7-14-10/h1,4,7,11-12,14-15H,2-3,5-6,8-9H2/t11-,12?/m0/s1 |
| InChiKey： | InChIKey=IOLDXBKIKRYYJW-PXYINDEMSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
