Molecular Structure:
CCD No.:CCD02028872
SELENA SEL10430986
Formula:C11 H18 N2 O4
MolWeight:242.273
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10430986 |
| English Synonyms： | SELENA SEL10430986 |
| MDL Number.： | MFCD13213968 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | C1CC1CN(CC(=O)O)C(=O)C2CC(CN2)O |
| InChi： | InChI=1S/C11H18N2O4/c14-8-3-9(12-4-8)11(17)13(6-10(15)16)5-7-1-2-7/h7-9,12,14H,1-6H2,(H,15,16) |
| InChiKey： | InChIKey=TYENIFAKSXJOLW-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
