Molecular Structure:
CCD No.:CCD02029065
SELENA SEL10431180
Formula:C14 H18 N2 O3
MolWeight:262.307
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10431180 |
| English Synonyms： | SELENA SEL10431180 |
| MDL Number.： | MFCD13214161 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1ccc(cc1)N(CCC(=O)O)C(=O)[C@@H]2CCCN2 |
| InChi： | InChI=1S/C14H18N2O3/c17-13(18)8-10-16(11-5-2-1-3-6-11)14(19)12-7-4-9-15-12/h1-3,5-6,12,15H,4,7-10H2,(H,17,18)/t12-/m0/s1 |
| InChiKey： | InChIKey=PHLVJMBTPDKQHD-LBPRGKRZSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
