* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10431909 |
| English Synonyms: | SELENA SEL10431909 |
| MDL Number.: | MFCD13214875 |
| H bond acceptor: | 7 |
| H bond donor: | 4 |
| Smile: | C1CNCCC1CC(=O)N[C@@H](CCC(=O)O)C(=O)O |
| InChi: | InChI=1S/C12H20N2O5/c15-10(7-8-3-5-13-6-4-8)14-9(12(18)19)1-2-11(16)17/h8-9,13H,1-7H2,(H,14,15)(H,16,17)(H,18,19)/t9-/m0/s1 |
| InChiKey: | InChIKey=MYNVNMXSZBITNZ-VIFPVBQESA-N |
* If the product has intellectual property rights, a license granted is must or contact us.