* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC429822 |
English Synonyms: | BCH-RESEARCH BC429822 |
MDL Number.: | MFCD13223186 |
H bond acceptor: | 6 |
H bond donor: | 2 |
Smile: | CN(CCC(=O)O)C(=O)Nc1nc2ccccc2s1 |
InChi: | InChI=1S/C12H13N3O3S/c1-15(7-6-10(16)17)12(18)14-11-13-8-4-2-3-5-9(8)19-11/h2-5H,6-7H2,1H3,(H,16,17)(H,13,14,18) |
InChiKey: | InChIKey=NAKBWYKJLLNGNV-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.