Molecular Structure:
CCD No.:CCD02057188
SELENA SEL10417957
Formula:C12 H14 N4 O3
MolWeight:262.268
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10417957 |
| English Synonyms： | SELENA SEL10417957 |
| MDL Number.： | MFCD13242370 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | CN(CC(=O)NCc1cc[nH]n1)C(=O)c2ccco2 |
| InChi： | InChI=1S/C12H14N4O3/c1-16(12(18)10-3-2-6-19-10)8-11(17)13-7-9-4-5-14-15-9/h2-6H,7-8H2,1H3,(H,13,17)(H,14,15) |
| InChiKey： | InChIKey=MBVLHQHNDCLRAO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
