Molecular Structure:
CCD No.:CCD02060237
SELENA SEL10425388
Formula:C15 H20 N2 O2
MolWeight:260.335
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10425388 |
| English Synonyms： | SELENA SEL10425388 |
| MDL Number.： | MFCD13245426 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | c1ccc2c(c1)C[C@@H](NC2)C(=O)N3CCCC(C3)O |
| InChi： | InChI=1S/C15H20N2O2/c18-13-6-3-7-17(10-13)15(19)14-8-11-4-1-2-5-12(11)9-16-14/h1-2,4-5,13-14,16,18H,3,6-10H2/t13?,14-/m1/s1 |
| InChiKey： | InChIKey=SUOFVMGKUZDQFS-ARLHGKGLSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
