* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | TIMTEC-BB SBB051150 |
English Synonyms: | TIMTEC-BB SBB051150 |
MDL Number.: | MFCD13248658 |
H bond acceptor: | 2 |
H bond donor: | 1 |
Smile: | CN(Cc1ccccc1)[C@@H]2CCCC[C@H]2O |
InChi: | InChI=1S/C14H21NO/c1-15(11-12-7-3-2-4-8-12)13-9-5-6-10-14(13)16/h2-4,7-8,13-14,16H,5-6,9-11H2,1H3/t13-,14-/m1/s1 |
InChiKey: | InChIKey=JBKPJCRFOPWOGF-ZIAGYGMSSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.