* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC820428 |
English Synonyms: | BCH-RESEARCH BC820428 |
MDL Number.: | MFCD13275717 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | CCN(CCC(=O)O)C(=O)NCc1ccccc1F |
InChi: | InChI=1S/C13H17FN2O3/c1-2-16(8-7-12(17)18)13(19)15-9-10-5-3-4-6-11(10)14/h3-6H,2,7-9H2,1H3,(H,15,19)(H,17,18) |
InChiKey: | InChIKey=HAFUNNDLIMJYQB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.