Molecular Structure:
CCD No.:CCD02067258
SELENA SEL10444398
Formula:C13 H22 N2 O3
MolWeight:254.328
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10444398 |
| English Synonyms： | SELENA SEL10444398 |
| MDL Number.： | MFCD13277173 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | CN(C1CC1)C(=O)NC2(CCCCCC2)C(=O)O |
| InChi： | InChI=1S/C13H22N2O3/c1-15(10-6-7-10)12(18)14-13(11(16)17)8-4-2-3-5-9-13/h10H,2-9H2,1H3,(H,14,18)(H,16,17) |
| InChiKey： | InChIKey=HAVIKDJIKSTXQT-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
