Molecular Structure:
CCD No.:CCD02069962
SELENA SEL10447412
Formula:C10 H16 N2 O6 S
MolWeight:292.31
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10447412 |
| English Synonyms： | SELENA SEL10447412 |
| MDL Number.： | MFCD13279877 |
| H bond acceptor： | 8 |
| H bond donor： | 2 |
| Smile： | C1CS(=O)(=O)CCN1C(=O)N2CC(CC2C(=O)O)O |
| InChi： | InChI=1S/C10H16N2O6S/c13-7-5-8(9(14)15)12(6-7)10(16)11-1-3-19(17,18)4-2-11/h7-8,13H,1-6H2,(H,14,15) |
| InChiKey： | InChIKey=MWKOPZKXLNOWLL-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
