Molecular Structure:
CCD No.:CCD02069971
SELENA SEL10447421
Formula:C11 H18 N2 O5 S
MolWeight:290.338
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10447421 |
| English Synonyms： | SELENA SEL10447421 |
| MDL Number.： | MFCD13279886 |
| H bond acceptor： | 7 |
| H bond donor： | 2 |
| Smile： | C1CCC(C1)(C(=O)O)NC(=O)N2CCS(=O)(=O)CC2 |
| InChi： | InChI=1S/C11H18N2O5S/c14-9(15)11(3-1-2-4-11)12-10(16)13-5-7-19(17,18)8-6-13/h1-8H2,(H,12,16)(H,14,15) |
| InChiKey： | InChIKey=NZZLXOIHTOKODO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
