* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SELENA SEL10447426 |
| English Synonyms: | SELENA SEL10447426 |
| MDL Number.: | MFCD13279891 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCCCC(C(=O)O)NC(=O)N1CCS(=O)(=O)CC1 |
| InChi: | InChI=1S/C11H20N2O5S/c1-2-3-4-9(10(14)15)12-11(16)13-5-7-19(17,18)8-6-13/h9H,2-8H2,1H3,(H,12,16)(H,14,15) |
| InChiKey: | InChIKey=YRNUJVSBSSZYSU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.