Molecular Structure:
CCD No.:CCD02076409
SELENA SEL10454593
Formula:C10 H13 Br Cl N O4 S
MolWeight:358.639
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10454593 |
| English Synonyms： | SELENA SEL10454593 |
| MDL Number.： | MFCD13286336 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1cc(c(cc1Br)Cl)S(=O)(=O)N(CCO)CCO |
| InChi： | InChI=1S/C10H13BrClNO4S/c11-8-1-2-10(9(12)7-8)18(16,17)13(3-5-14)4-6-15/h1-2,7,14-15H,3-6H2 |
| InChiKey： | InChIKey=BURKNBQIGKAWAC-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
