* If the product has intellectual property rights, a license granted is must or contact us.
|
|
Product Name: | BCH-RESEARCH BC668788 |
English Synonyms: | BCH-RESEARCH BC668788 |
MDL Number.: | MFCD13286407 |
H bond acceptor: | 4 |
H bond donor: | 0 |
Smile: | CC(C)N(CCC#N)S(=O)(=O)c1ccccc1Br |
InChi: | InChI=1S/C12H15BrN2O2S/c1-10(2)15(9-5-8-14)18(16,17)12-7-4-3-6-11(12)13/h3-4,6-7,10H,5,9H2,1-2H3 |
InChiKey: | InChIKey=YVJLSEPZJHSOFF-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.