Molecular Structure:
CCD No.:CCD02079643
SELENA SEL10458058
Formula:C10 H12 Cl N3 O2 S2
MolWeight:305.809
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10458058 |
| English Synonyms： | SELENA SEL10458058 |
| MDL Number.： | MFCD13289575 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CC1CCN(C1)S(=O)(=O)c2c(nc3n2ccs3)Cl |
| InChi： | InChI=1S/C10H12ClN3O2S2/c1-7-2-3-13(6-7)18(15,16)9-8(11)12-10-14(9)4-5-17-10/h4-5,7H,2-3,6H2,1H3 |
| InChiKey： | InChIKey=MYSJIJBSXDHPLI-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
