* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC1242714 |
English Synonyms: | BCH-RESEARCH BC1242714 |
MDL Number.: | MFCD13292724 |
H bond acceptor: | 6 |
H bond donor: | 3 |
Smile: | c1cc(ccc1CN)S(=O)(=O)N(CCO)CCO |
InChi: | InChI=1S/C11H18N2O4S/c12-9-10-1-3-11(4-2-10)18(16,17)13(5-7-14)6-8-15/h1-4,14-15H,5-9,12H2 |
InChiKey: | InChIKey=RLWCGRYAFMIYRD-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.