Molecular Structure:
CCD No.:CCD02082831
SELENA SEL10461592
Formula:C10 H15 N O5 S
MolWeight:261.297
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10461592 |
| English Synonyms： | SELENA SEL10461592 |
| MDL Number.： | MFCD13292770 |
| H bond acceptor： | 6 |
| H bond donor： | 3 |
| Smile： | c1cc(ccc1O)S(=O)(=O)N(CCO)CCO |
| InChi： | InChI=1S/C10H15NO5S/c12-7-5-11(6-8-13)17(15,16)10-3-1-9(14)2-4-10/h1-4,12-14H,5-8H2 |
| InChiKey： | InChIKey=NBZZCKDHVOIOOK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
