Molecular Structure:
CCD No.:CCD02085248
SELENA SEL10464119
Formula:C12 H18 Br N O3 S
MolWeight:336.248
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10464119 |
| English Synonyms： | SELENA SEL10464119 |
| MDL Number.： | MFCD13316782 |
| H bond acceptor： | 4 |
| H bond donor： | 2 |
| Smile： | CC(C)CC(CO)NS(=O)(=O)c1ccccc1Br |
| InChi： | InChI=1S/C12H18BrNO3S/c1-9(2)7-10(8-15)14-18(16,17)12-6-4-3-5-11(12)13/h3-6,9-10,14-15H,7-8H2,1-2H3 |
| InChiKey： | InChIKey=JKCOSWZHNJSXRO-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
