* If the product has intellectual property rights, a license granted is must or contact us.
Basic Information |
|
Product Name: | BCH-RESEARCH BC820518 |
English Synonyms: | BCH-RESEARCH BC820518 |
MDL Number.: | MFCD13318141 |
H bond acceptor: | 5 |
H bond donor: | 2 |
Smile: | c1cc(ccc1F)S(=O)(=O)NCCOCCO |
InChi: | InChI=1S/C10H14FNO4S/c11-9-1-3-10(4-2-9)17(14,15)12-5-7-16-8-6-13/h1-4,12-13H,5-8H2 |
InChiKey: | InChIKey=KPGBZAOJTUFTDR-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.