Molecular Structure:
CCD No.:CCD02097348
SELENA SEL10477685
Formula:C13 H14 N2 O3
MolWeight:246.265
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10477685 |
| English Synonyms： | SELENA SEL10477685 |
| MDL Number.： | MFCD13328897 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1c2c(cc3c1OCCO3)nc([nH]2)C4CCOC4 |
| InChi： | InChI=1S/C13H14N2O3/c1-2-16-7-8(1)13-14-9-5-11-12(6-10(9)15-13)18-4-3-17-11/h5-6,8H,1-4,7H2,(H,14,15) |
| InChiKey： | InChIKey=LNDICAPQTLIMNY-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
