Molecular Structure:
CCD No.:CCD02100314
SELENA SEL10480862
Formula:C16 H21 N O S
MolWeight:275.414
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10480862 |
| English Synonyms： | SELENA SEL10480862 |
| MDL Number.： | MFCD13331866 |
| H bond acceptor： | 2 |
| H bond donor： | 1 |
| Smile： | c1c2c(cc3c1C(CCCS3=O)NC4CC4)CCC2 |
| InChi： | InChI=1S/C16H21NOS/c18-19-8-2-5-15(17-13-6-7-13)14-9-11-3-1-4-12(11)10-16(14)19/h9-10,13,15,17H,1-8H2 |
| InChiKey： | InChIKey=NNLBVULPWHQHDU-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
