Molecular Structure:
CCD No.:CCD02101072
SELENA SEL10481688
Formula:C14 H17 N O3
MolWeight:247.292
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10481688 |
| English Synonyms： | SELENA SEL10481688 |
| MDL Number.： | MFCD13332627 |
| H bond acceptor： | 4 |
| H bond donor： | 1 |
| Smile： | CCNC(C)c1c(c2cc3c(cc2o1)OCO3)C |
| InChi： | InChI=1S/C14H17NO3/c1-4-15-9(3)14-8(2)10-5-12-13(17-7-16-12)6-11(10)18-14/h5-6,9,15H,4,7H2,1-3H3 |
| InChiKey： | InChIKey=CLMZMPKMNXBJLN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
