Molecular Structure:
CCD No.:CCD02105198
SELENA SEL10486647
Formula:C12 H14 N2 O5
MolWeight:266.252
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10486647 |
| English Synonyms： | SELENA SEL10486647 |
| MDL Number.： | MFCD13336837 |
| H bond acceptor： | 7 |
| H bond donor： | 1 |
| Smile： | CCN(CC(=O)O)C(=O)c1cc(ccc1C)[N+](=O)[O-] |
| InChi： | InChI=1S/C12H14N2O5/c1-3-13(7-11(15)16)12(17)10-6-9(14(18)19)5-4-8(10)2/h4-6H,3,7H2,1-2H3,(H,15,16) |
| InChiKey： | InChIKey=XDGRWRHTELRGCB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
