Molecular Structure:
CCD No.:CCD02105638
SELENA SEL10487105
Formula:C14 H17 N3 O2
MolWeight:259.307
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10487105 |
| English Synonyms： | SELENA SEL10487105 |
| MDL Number.： | MFCD13337278 |
| H bond acceptor： | 5 |
| H bond donor： | 2 |
| Smile： | c1c2c(cc3c1OCCO3)nc([nH]2)C4(CCCC4)N |
| InChi： | InChI=1S/C14H17N3O2/c15-14(3-1-2-4-14)13-16-9-7-11-12(8-10(9)17-13)19-6-5-18-11/h7-8H,1-6,15H2,(H,16,17) |
| InChiKey： | InChIKey=YVBFBDPBQQYEHD-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
