Molecular Structure:
CCD No.:CCD02108717
SELENA SEL10492838
Formula:C11 H19 N3 O3 S2
MolWeight:305.421
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10492838 |
| English Synonyms： | SELENA SEL10492838 |
| MDL Number.： | MFCD13340362 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCN(CC)C(=O)CN(C)S(=O)(=O)c1cc(cs1)N |
| InChi： | InChI=1S/C11H19N3O3S2/c1-4-14(5-2)10(15)7-13(3)19(16,17)11-6-9(12)8-18-11/h6,8H,4-5,7,12H2,1-3H3 |
| InChiKey： | InChIKey=DRNHMGOXHXSSKX-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
