Molecular Structure:
CCD No.:CCD02108744
SELENA SEL10492870
Formula:C11 H16 N2 O4 S2
MolWeight:304.389
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10492870 |
| English Synonyms： | SELENA SEL10492870 |
| MDL Number.： | MFCD13340390 |
| H bond acceptor： | 6 |
| H bond donor： | 1 |
| Smile： | CCOC(=O)CN(C1CC1)S(=O)(=O)c2cc(cs2)N |
| InChi： | InChI=1S/C11H16N2O4S2/c1-2-17-10(14)6-13(9-3-4-9)19(15,16)11-5-8(12)7-18-11/h5,7,9H,2-4,6,12H2,1H3 |
| InChiKey： | InChIKey=LWGIQVOYZAQCCA-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
