Molecular Structure:
CCD No.:CCD02108753
SELENA SEL10492879
Formula:C10 H17 N3 O3 S2
MolWeight:291.394
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10492879 |
| English Synonyms： | SELENA SEL10492879 |
| MDL Number.： | MFCD13340399 |
| H bond acceptor： | 6 |
| H bond donor： | 2 |
| Smile： | CCCNC(=O)CN(C)S(=O)(=O)c1cc(cs1)N |
| InChi： | InChI=1S/C10H17N3O3S2/c1-3-4-12-9(14)6-13(2)18(15,16)10-5-8(11)7-17-10/h5,7H,3-4,6,11H2,1-2H3,(H,12,14) |
| InChiKey： | InChIKey=GKVICONXTSUUJE-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
