Molecular Structure:
CCD No.:CCD02108780
SELENA SEL10492912
Formula:C10 H13 N3 O2 S2
MolWeight:271.364
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10492912 |
| English Synonyms： | SELENA SEL10492912 |
| MDL Number.： | MFCD13340426 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | c1c(csc1S(=O)(=O)N(CCC#N)C2CC2)N |
| InChi： | InChI=1S/C10H13N3O2S2/c11-4-1-5-13(9-2-3-9)17(14,15)10-6-8(12)7-16-10/h6-7,9H,1-3,5,12H2 |
| InChiKey： | InChIKey=RLHRWBDGGFUXGN-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
