Molecular Structure:
CCD No.:CCD02109152
SELENA SEL10493333
Formula:C11 H13 Br Cl N3 O2 S
MolWeight:366.666
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10493333 |
| English Synonyms： | SELENA SEL10493333 |
| MDL Number.： | MFCD13340799 |
| H bond acceptor： | 5 |
| H bond donor： | 0 |
| Smile： | CCN(CC(C)C#N)S(=O)(=O)c1cc(cnc1Cl)Br |
| InChi： | InChI=1S/C11H13BrClN3O2S/c1-3-16(7-8(2)5-14)19(17,18)10-4-9(12)6-15-11(10)13/h4,6,8H,3,7H2,1-2H3 |
| InChiKey： | InChIKey=XWDVXNZBMUDICB-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
