* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | BCH-RESEARCH BC933994 |
| English Synonyms: | BCH-RESEARCH BC933994 |
| MDL Number.: | MFCD13344707 |
| H bond acceptor: | 4 |
| H bond donor: | 3 |
| Smile: | c1cc(c(cc1N)C(=O)N)NCC2CCCC2 |
| InChi: | InChI=1S/C13H19N3O/c14-10-5-6-12(11(7-10)13(15)17)16-8-9-3-1-2-4-9/h5-7,9,16H,1-4,8,14H2,(H2,15,17) |
| InChiKey: | InChIKey=MEBHYGVCSJXCEW-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.