Molecular Structure:
CCD No.:CCD02114310
SELENA SEL10498739
Formula:C11 H15 N O4 S2
MolWeight:289.375
* If the product has intellectual property rights, a license granted is must or contact us.
- Detailed
- Suppliers(0)
- Buyers(0)
- Spectrum(0)
- MSDS(0)
- Price(0)
|
|
| Product Name： | SELENA SEL10498739 |
| English Synonyms： | SELENA SEL10498739 |
| MDL Number.： | MFCD13345958 |
| H bond acceptor： | 5 |
| H bond donor： | 1 |
| Smile： | CC(C)OC(=O)c1c2c(sc1N)CS(=O)(=O)CC2 |
| InChi： | InChI=1S/C11H15NO4S2/c1-6(2)16-11(13)9-7-3-4-18(14,15)5-8(7)17-10(9)12/h6H,3-5,12H2,1-2H3 |
| InChiKey： | InChIKey=IDTYGGWUICPTQK-UHFFFAOYSA-N |
Basic Information
* If the product has intellectual property rights, a license granted is must or contact us.
