* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL089484 |
| English Synonyms: | SYNTHON-LAB SL089484 |
| MDL Number.: | MFCD13368924 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CCn1c(nnc1SC(C)c2[nH]c(=O)c3ccccc3n2)COc4c(cccc4C)C |
| InChi: | InChI=1S/C23H25N5O2S/c1-5-28-19(13-30-20-14(2)9-8-10-15(20)3)26-27-23(28)31-16(4)21-24-18-12-7-6-11-17(18)22(29)25-21/h6-12,16H,5,13H2,1-4H3,(H,24,25,29) |
| InChiKey: | InChIKey=URQWDJKTEBMXPT-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.