* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL089525 |
| English Synonyms: | SYNTHON-LAB SL089525 |
| MDL Number.: | MFCD13368932 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CC(C(=O)Nc1ccc(cc1F)F)Sc2nnc(n2CC=C)c3cccnc3 |
| InChi: | InChI=1S/C19H17F2N5OS/c1-3-9-26-17(13-5-4-8-22-11-13)24-25-19(26)28-12(2)18(27)23-16-7-6-14(20)10-15(16)21/h3-8,10-12H,1,9H2,2H3,(H,23,27) |
| InChiKey: | InChIKey=KHKKAATVLHZXTA-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.