* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL089492 |
| English Synonyms: | SYNTHON-LAB SL089492 |
| MDL Number.: | MFCD13368951 |
| H bond acceptor: | 9 |
| H bond donor: | 2 |
| Smile: | CC(c1[nH]c(=O)c2ccccc2n1)Sc3nnc(n3C)CNC(=O)c4ccco4 |
| InChi: | InChI=1S/C19H18N6O3S/c1-11(16-21-13-7-4-3-6-12(13)17(26)22-16)29-19-24-23-15(25(19)2)10-20-18(27)14-8-5-9-28-14/h3-9,11H,10H2,1-2H3,(H,20,27)(H,21,22,26) |
| InChiKey: | InChIKey=ALZMZVDOZQXQSB-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.