* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL088997 |
| English Synonyms: | SYNTHON-LAB SL088997 |
| MDL Number.: | MFCD13368968 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | C=CCn1c(nnc1SCC(=O)NC2=NCCS2)c3cccnc3 |
| InChi: | InChI=1S/C15H16N6OS2/c1-2-7-21-13(11-4-3-5-16-9-11)19-20-15(21)24-10-12(22)18-14-17-6-8-23-14/h2-5,9H,1,6-8,10H2,(H,17,18,22) |
| InChiKey: | InChIKey=BKQSSMFQALCXQU-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.