* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL089027 |
| English Synonyms: | SYNTHON-LAB SL089027 |
| MDL Number.: | MFCD13368974 |
| H bond acceptor: | 7 |
| H bond donor: | 1 |
| Smile: | CC(C(=O)Nc1nc2ccccc2s1)Sc3nnc(n3CC=C)c4ccncc4 |
| InChi: | InChI=1S/C20H18N6OS2/c1-3-12-26-17(14-8-10-21-11-9-14)24-25-20(26)28-13(2)18(27)23-19-22-15-6-4-5-7-16(15)29-19/h3-11,13H,1,12H2,2H3,(H,22,23,27) |
| InChiKey: | InChIKey=LRZCMLGSYVFNLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.