* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL090841 |
| English Synonyms: | SYNTHON-LAB SL090841 |
| MDL Number.: | MFCD13368992 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | CCn1c(nnc1SCC(=O)Nc2ccc(cc2)S(=O)(=O)N)c3ccc(cc3)F |
| InChi: | InChI=1S/C18H18FN5O3S2/c1-2-24-17(12-3-5-13(19)6-4-12)22-23-18(24)28-11-16(25)21-14-7-9-15(10-8-14)29(20,26)27/h3-10H,2,11H2,1H3,(H,21,25)(H2,20,26,27) |
| InChiKey: | InChIKey=RYHULQSIBCWNLX-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.