* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL090842 |
| English Synonyms: | SYNTHON-LAB SL090842 |
| MDL Number.: | MFCD13368993 |
| H bond acceptor: | 8 |
| H bond donor: | 2 |
| Smile: | C=CCn1c(nnc1SCC(=O)Nc2ccc(cc2)S(=O)(=O)N)c3cccc(c3)F |
| InChi: | InChI=1S/C19H18FN5O3S2/c1-2-10-25-18(13-4-3-5-14(20)11-13)23-24-19(25)29-12-17(26)22-15-6-8-16(9-7-15)30(21,27)28/h2-9,11H,1,10,12H2,(H,22,26)(H2,21,27,28) |
| InChiKey: | InChIKey=QVIIEUZGWAJAIZ-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.