* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL065801 |
| English Synonyms: | SYNTHON-LAB SL065801 |
| MDL Number.: | MFCD13369934 |
| H bond acceptor: | 6 |
| H bond donor: | 1 |
| Smile: | CCOC(=O)COc1ccccc1/C=C\2/C(=O)N/C(=N/c3ccc(cc3)Br)/S2 |
| InChi: | InChI=1S/C20H17BrN2O4S/c1-2-26-18(24)12-27-16-6-4-3-5-13(16)11-17-19(25)23-20(28-17)22-15-9-7-14(21)8-10-15/h3-11H,2,12H2,1H3,(H,22,23,25)/b17-11- |
| InChiKey: | InChIKey=OGLMWTVTMUJNEB-BOPFTXTBSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.