* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL071745 |
| English Synonyms: | SYNTHON-LAB SL071745 |
| MDL Number.: | MFCD13370041 |
| H bond acceptor: | 2 |
| H bond donor: | 0 |
| Smile: | CCN1c2ccccc2C(C1=O)Cc3cccc(c3)F |
| InChi: | InChI=1S/C17H16FNO/c1-2-19-16-9-4-3-8-14(16)15(17(19)20)11-12-6-5-7-13(18)10-12/h3-10,15H,2,11H2,1H3 |
| InChiKey: | InChIKey=PPXDUEOOTDMGQI-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.