* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL069550 |
| English Synonyms: | SYNTHON-LAB SL069550 |
| MDL Number.: | MFCD13370914 |
| H bond acceptor: | 8 |
| H bond donor: | 0 |
| Smile: | CC(=O)Oc1c(cc(cc1[N+](=O)[O-])OC)/C=C\2/C(=O)SC(=N2)SCC=C |
| InChi: | InChI=1S/C16H14N2O6S2/c1-4-5-25-16-17-12(15(20)26-16)7-10-6-11(23-3)8-13(18(21)22)14(10)24-9(2)19/h4,6-8H,1,5H2,2-3H3/b12-7- |
| InChiKey: | InChIKey=IODHZQJJMFLKON-GHXNOFRVSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.