* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL070739 |
| English Synonyms: | SYNTHON-LAB SL070739 |
| MDL Number.: | MFCD13370969 |
| H bond acceptor: | 7 |
| H bond donor: | 2 |
| Smile: | CCN1C(=C(C(NC1=O)c2cc(c(c(c2)Br)O)OCC)C(=O)OCC)C |
| InChi: | InChI=1S/C18H23BrN2O5/c1-5-21-10(4)14(17(23)26-7-3)15(20-18(21)24)11-8-12(19)16(22)13(9-11)25-6-2/h8-9,15,22H,5-7H2,1-4H3,(H,20,24) |
| InChiKey: | InChIKey=GVAXPGIUTYSYBN-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.