* If the product has intellectual property rights, a license granted is must or contact us.
|
|
| Product Name: | SYNTHON-LAB SL071595 |
| English Synonyms: | SYNTHON-LAB SL071595 |
| MDL Number.: | MFCD13372743 |
| H bond acceptor: | 3 |
| H bond donor: | 1 |
| Smile: | CC(C)Oc1ccc(cc1)CC2c3cc(ccc3NC2=O)Br |
| InChi: | InChI=1S/C18H18BrNO2/c1-11(2)22-14-6-3-12(4-7-14)9-16-15-10-13(19)5-8-17(15)20-18(16)21/h3-8,10-11,16H,9H2,1-2H3,(H,20,21) |
| InChiKey: | InChIKey=TVEWOWMVRPLDPE-UHFFFAOYSA-N |
* If the product has intellectual property rights, a license granted is must or contact us.